C20H22N6O3 — CID 167783168
3-[6-[4-(1-methylpyrrolidin-3-yl)triazol-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 167783168) has the molecular formula C20H22N6O3 and a molecular weight of 394.44 g/mol. Its IUPAC name is 3-[6-[4-(1-methylpyrrolidin-3-yl)triazol-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[4-(1-methylpyrrolidin-3-yl)triazol-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 167783168 |
| Molecular Formula | C20H22N6O3 |
| Molecular Weight | 394.44 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | 3-[6-[4-(1-methylpyrrolidin-3-yl)triazol-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | CN1CCC(c2cn(-c3ccc4c(c3)CN(C3CCC(=O)NC3=O)C4=O)nn2)C1 |
| InChI | InChI=1S/C20H22N6O3/c1-24-7-6-12(9-24)16-11-26(23-22-16)14-2-3-15-13(8-14)10-25(20(15)29)17-4-5-18(27)21-19(17)28/h2-3,8,11-12,17H,4-7,9-10H2,1H3,(H,21,27,28) |
| InChIKey | PYVPJISCLWRJCU-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 100.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.44 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|