C19H20N6O4 — CID 167858573
3-[6-(4-morpholin-3-yltriazol-1-yl)-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 167858573) has the molecular formula C19H20N6O4 and a molecular weight of 396.41 g/mol. Its IUPAC name is 3-[6-(4-morpholin-3-yltriazol-1-yl)-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-(4-morpholin-3-yltriazol-1-yl)-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 167858573 |
| Molecular Formula | C19H20N6O4 |
| Molecular Weight | 396.41 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | 3-[6-(4-morpholin-3-yltriazol-1-yl)-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(-n4cc(C5COCCN5)nn4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C19H20N6O4/c26-17-4-3-16(18(27)21-17)24-8-11-7-12(1-2-13(11)19(24)28)25-9-14(22-23-25)15-10-29-6-5-20-15/h1-2,7,9,15-16,20H,3-6,8,10H2,(H,21,26,27) |
| InChIKey | VYWRMSPMAPDHGH-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 118.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.41 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|