C21H17FN6O3 — CID 166422852
3-[6-[4-(2-amino-5-fluorophenyl)triazol-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 166422852) has the molecular formula C21H17FN6O3 and a molecular weight of 420.40 g/mol. Its IUPAC name is 3-[6-[4-(2-amino-5-fluorophenyl)triazol-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[4-(2-amino-5-fluorophenyl)triazol-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 166422852 |
| Molecular Formula | C21H17FN6O3 |
| Molecular Weight | 420.40 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | 3-[6-[4-(2-amino-5-fluorophenyl)triazol-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | Nc1ccc(F)cc1-c1cn(-c2ccc3c(c2)CN(C2CCC(=O)NC2=O)C3=O)nn1 |
| InChI | InChI=1S/C21H17FN6O3/c22-12-1-4-16(23)15(8-12)17-10-28(26-25-17)13-2-3-14-11(7-13)9-27(21(14)31)18-5-6-19(29)24-20(18)30/h1-4,7-8,10,18H,5-6,9,23H2,(H,24,29,30) |
| InChIKey | UYKRPWKGGQKSPQ-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 123.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.40 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|