C23H18FN5O5 — CID 167925137
methyl 2-[1-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]triazol-4-yl]-6-fluorobenzoate (PubChem CID 167925137) has the molecular formula C23H18FN5O5 and a molecular weight of 463.43 g/mol. Its IUPAC name is methyl 2-[1-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]triazol-4-yl]-6-fluorobenzoate.
| Compound Name | methyl 2-[1-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]triazol-4-yl]-6-fluorobenzoate |
|---|---|
| PubChem CID | 167925137 |
| Molecular Formula | C23H18FN5O5 |
| Molecular Weight | 463.43 g/mol |
| Exact Mass | 463.13 |
| IUPAC Name | methyl 2-[1-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]triazol-4-yl]-6-fluorobenzoate |
| SMILES | COC(=O)c1c(F)cccc1-c1cn(-c2ccc3c(c2)CN(C2CCC(=O)NC2=O)C3=O)nn1 |
| InChI | InChI=1S/C23H18FN5O5/c1-34-23(33)20-15(3-2-4-16(20)24)17-11-29(27-26-17)13-5-6-14-12(9-13)10-28(22(14)32)18-7-8-19(30)25-21(18)31/h2-6,9,11,18H,7-8,10H2,1H3,(H,25,30,31) |
| InChIKey | UGWNJWJDYRNGKV-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 123.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.43 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|