C23H20FN7O4 — CID 167907546
1-[[1-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]triazol-4-yl]methyl]-3-(2-fluorophenyl)urea (PubChem CID 167907546) has the molecular formula C23H20FN7O4 and a molecular weight of 477.46 g/mol. Its IUPAC name is 1-[[1-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]triazol-4-yl]methyl]-3-(2-fluorophenyl)urea.
| Compound Name | 1-[[1-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]triazol-4-yl]methyl]-3-(2-fluorophenyl)urea |
|---|---|
| PubChem CID | 167907546 |
| Molecular Formula | C23H20FN7O4 |
| Molecular Weight | 477.46 g/mol |
| Exact Mass | 477.16 |
| IUPAC Name | 1-[[1-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]triazol-4-yl]methyl]-3-(2-fluorophenyl)urea |
| SMILES | O=C1CCC(N2Cc3cc(-n4cc(CNC(=O)Nc5ccccc5F)nn4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C23H20FN7O4/c24-17-3-1-2-4-18(17)26-23(35)25-10-14-12-31(29-28-14)15-5-6-16-13(9-15)11-30(22(16)34)19-7-8-20(32)27-21(19)33/h1-6,9,12,19H,7-8,10-11H2,(H2,25,26,35)(H,27,32,33) |
| InChIKey | CCCHWDKUAYJMDS-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 138.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.46 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|