C24H19N7O4 — CID 167857019
3-cyano-N-[[1-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]triazol-4-yl]methyl]benzamide (PubChem CID 167857019) has the molecular formula C24H19N7O4 and a molecular weight of 469.46 g/mol. Its IUPAC name is 3-cyano-N-[[1-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]triazol-4-yl]methyl]benzamide.
| Compound Name | 3-cyano-N-[[1-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]triazol-4-yl]methyl]benzamide |
|---|---|
| PubChem CID | 167857019 |
| Molecular Formula | C24H19N7O4 |
| Molecular Weight | 469.46 g/mol |
| Exact Mass | 469.15 |
| IUPAC Name | 3-cyano-N-[[1-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]triazol-4-yl]methyl]benzamide |
| SMILES | N#Cc1cccc(C(=O)NCc2cn(-c3ccc4c(c3)CN(C3CCC(=O)NC3=O)C4=O)nn2)c1 |
| InChI | InChI=1S/C24H19N7O4/c25-10-14-2-1-3-15(8-14)22(33)26-11-17-13-31(29-28-17)18-4-5-19-16(9-18)12-30(24(19)35)20-6-7-21(32)27-23(20)34/h1-5,8-9,13,20H,6-7,11-12H2,(H,26,33)(H,27,32,34) |
| InChIKey | WBHHSFPTFJPPCZ-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 150.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.46 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|