C27H28N6O4 — CID 166428190
N-[(4-tert-butylphenyl)methyl]-1-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]triazole-4-carboxamide (PubChem CID 166428190) has the molecular formula C27H28N6O4 and a molecular weight of 500.56 g/mol. Its IUPAC name is N-[(4-tert-butylphenyl)methyl]-1-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]triazole-4-carboxamide.
| Compound Name | N-[(4-tert-butylphenyl)methyl]-1-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 166428190 |
| Molecular Formula | C27H28N6O4 |
| Molecular Weight | 500.56 g/mol |
| Exact Mass | 500.22 |
| IUPAC Name | N-[(4-tert-butylphenyl)methyl]-1-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]triazole-4-carboxamide |
| SMILES | CC(C)(C)c1ccc(CNC(=O)c2cn(-c3ccc4c(c3)CN(C3CCC(=O)NC3=O)C4=O)nn2)cc1 |
| InChI | InChI=1S/C27H28N6O4/c1-27(2,3)18-6-4-16(5-7-18)13-28-24(35)21-15-33(31-30-21)19-8-9-20-17(12-19)14-32(26(20)37)22-10-11-23(34)29-25(22)36/h4-9,12,15,22H,10-11,13-14H2,1-3H3,(H,28,35)(H,29,34,36) |
| InChIKey | FXTCYZQNEXOTPD-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 126.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.56 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|