C25H23N7O4 — CID 167990087
N-(2,3-dihydro-1H-indol-6-ylmethyl)-1-[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]triazole-4-carboxamide (PubChem CID 167990087) has the molecular formula C25H23N7O4 and a molecular weight of 485.50 g/mol. Its IUPAC name is N-(2,3-dihydro-1H-indol-6-ylmethyl)-1-[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]triazole-4-carboxamide.
| Compound Name | N-(2,3-dihydro-1H-indol-6-ylmethyl)-1-[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 167990087 |
| Molecular Formula | C25H23N7O4 |
| Molecular Weight | 485.50 g/mol |
| Exact Mass | 485.18 |
| IUPAC Name | N-(2,3-dihydro-1H-indol-6-ylmethyl)-1-[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]triazole-4-carboxamide |
| SMILES | O=C1CCC(N2Cc3ccc(-n4cc(C(=O)NCc5ccc6c(c5)NCC6)nn4)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C25H23N7O4/c33-22-6-5-21(24(35)28-22)31-12-16-3-4-17(10-18(16)25(31)36)32-13-20(29-30-32)23(34)27-11-14-1-2-15-7-8-26-19(15)9-14/h1-4,9-10,13,21,26H,5-8,11-12H2,(H,27,34)(H,28,33,35) |
| InChIKey | LNFUTCXUYAENOD-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 138.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.50 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|