C22H21N7O4S — CID 167940979
1-[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]-N-[2-(1,3-thiazol-2-yl)propan-2-yl]triazole-4-carboxamide (PubChem CID 167940979) has the molecular formula C22H21N7O4S and a molecular weight of 479.52 g/mol. Its IUPAC name is 1-[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]-N-[2-(1,3-thiazol-2-yl)propan-2-yl]triazole-4-carboxamide.
| Compound Name | 1-[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]-N-[2-(1,3-thiazol-2-yl)propan-2-yl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 167940979 |
| Molecular Formula | C22H21N7O4S |
| Molecular Weight | 479.52 g/mol |
| Exact Mass | 479.14 |
| IUPAC Name | 1-[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]-N-[2-(1,3-thiazol-2-yl)propan-2-yl]triazole-4-carboxamide |
| SMILES | CC(C)(NC(=O)c1cn(-c2ccc3c(c2)C(=O)N(C2CCC(=O)NC2=O)C3)nn1)c1nccs1 |
| InChI | InChI=1S/C22H21N7O4S/c1-22(2,21-23-7-8-34-21)25-18(31)15-11-29(27-26-15)13-4-3-12-10-28(20(33)14(12)9-13)16-5-6-17(30)24-19(16)32/h3-4,7-9,11,16H,5-6,10H2,1-2H3,(H,25,31)(H,24,30,32) |
| InChIKey | AENLMDRDHYCJOX-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 139.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.52 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|