C24H28N6O5 — CID 167908649
1-[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]-N-[(1-hydroxy-3-methylcyclohexyl)methyl]triazole-4-carboxamide (PubChem CID 167908649) has the molecular formula C24H28N6O5 and a molecular weight of 480.53 g/mol. Its IUPAC name is 1-[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]-N-[(1-hydroxy-3-methylcyclohexyl)methyl]triazole-4-carboxamide.
| Compound Name | 1-[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]-N-[(1-hydroxy-3-methylcyclohexyl)methyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 167908649 |
| Molecular Formula | C24H28N6O5 |
| Molecular Weight | 480.53 g/mol |
| Exact Mass | 480.21 |
| IUPAC Name | 1-[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]-N-[(1-hydroxy-3-methylcyclohexyl)methyl]triazole-4-carboxamide |
| SMILES | CC1CCCC(O)(CNC(=O)c2cn(-c3ccc4c(c3)C(=O)N(C3CCC(=O)NC3=O)C4)nn2)C1 |
| InChI | InChI=1S/C24H28N6O5/c1-14-3-2-8-24(35,10-14)13-25-21(32)18-12-30(28-27-18)16-5-4-15-11-29(23(34)17(15)9-16)19-6-7-20(31)26-22(19)33/h4-5,9,12,14,19,35H,2-3,6-8,10-11,13H2,1H3,(H,25,32)(H,26,31,33) |
| InChIKey | ROCLKCSUNHCBHO-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 146.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.53 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|