C25H23FN6O4 — CID 167796084
1-[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]-N-(3-ethyl-5-fluoro-2-methylphenyl)triazole-4-carboxamide (PubChem CID 167796084) has the molecular formula C25H23FN6O4 and a molecular weight of 490.50 g/mol. Its IUPAC name is 1-[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]-N-(3-ethyl-5-fluoro-2-methylphenyl)triazole-4-carboxamide.
| Compound Name | 1-[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]-N-(3-ethyl-5-fluoro-2-methylphenyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 167796084 |
| Molecular Formula | C25H23FN6O4 |
| Molecular Weight | 490.50 g/mol |
| Exact Mass | 490.18 |
| IUPAC Name | 1-[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]-N-(3-ethyl-5-fluoro-2-methylphenyl)triazole-4-carboxamide |
| SMILES | CCc1cc(F)cc(NC(=O)c2cn(-c3ccc4c(c3)C(=O)N(C3CCC(=O)NC3=O)C4)nn2)c1C |
| InChI | InChI=1S/C25H23FN6O4/c1-3-14-8-16(26)9-19(13(14)2)27-23(34)20-12-32(30-29-20)17-5-4-15-11-31(25(36)18(15)10-17)21-6-7-22(33)28-24(21)35/h4-5,8-10,12,21H,3,6-7,11H2,1-2H3,(H,27,34)(H,28,33,35) |
| InChIKey | CMYTXNLIBRPREP-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 126.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.50 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|