C25H21N7O4 — CID 167928540
1-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-N-(1-methylindol-7-yl)triazole-4-carboxamide (PubChem CID 167928540) has the molecular formula C25H21N7O4 and a molecular weight of 483.49 g/mol. Its IUPAC name is 1-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-N-(1-methylindol-7-yl)triazole-4-carboxamide.
| Compound Name | 1-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-N-(1-methylindol-7-yl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 167928540 |
| Molecular Formula | C25H21N7O4 |
| Molecular Weight | 483.49 g/mol |
| Exact Mass | 483.17 |
| IUPAC Name | 1-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-N-(1-methylindol-7-yl)triazole-4-carboxamide |
| SMILES | Cn1ccc2cccc(NC(=O)c3cn(-c4ccc5c(c4)CN(C4CCC(=O)NC4=O)C5=O)nn3)c21 |
| InChI | InChI=1S/C25H21N7O4/c1-30-10-9-14-3-2-4-18(22(14)30)26-23(34)19-13-32(29-28-19)16-5-6-17-15(11-16)12-31(25(17)36)20-7-8-21(33)27-24(20)35/h2-6,9-11,13,20H,7-8,12H2,1H3,(H,26,34)(H,27,33,35) |
| InChIKey | KQNUEVLIDBUCAL-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 131.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.49 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|