C24H22N6O5 — CID 166428213
1-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-N-[(1R)-1-(2-hydroxyphenyl)ethyl]triazole-4-carboxamide (PubChem CID 166428213) has the molecular formula C24H22N6O5 and a molecular weight of 474.48 g/mol. Its IUPAC name is 1-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-N-[(1R)-1-(2-hydroxyphenyl)ethyl]triazole-4-carboxamide.
| Compound Name | 1-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-N-[(1R)-1-(2-hydroxyphenyl)ethyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 166428213 |
| Molecular Formula | C24H22N6O5 |
| Molecular Weight | 474.48 g/mol |
| Exact Mass | 474.17 |
| IUPAC Name | 1-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-N-[(1R)-1-(2-hydroxyphenyl)ethyl]triazole-4-carboxamide |
| SMILES | C[C@@H](NC(=O)c1cn(-c2ccc3c(c2)CN(C2CCC(=O)NC2=O)C3=O)nn1)c1ccccc1O |
| InChI | InChI=1S/C24H22N6O5/c1-13(16-4-2-3-5-20(16)31)25-22(33)18-12-30(28-27-18)15-6-7-17-14(10-15)11-29(24(17)35)19-8-9-21(32)26-23(19)34/h2-7,10,12-13,19,31H,8-9,11H2,1H3,(H,25,33)(H,26,32,34)/t13-,19?/m1/s1 |
| InChIKey | MSIYGTWMWAFOSC-BSOCMFCZSA-N |
| XLogP | 1.22 |
| TPSA | 146.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.48 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|