C24H24N6O4 — CID 167924410
N-[[(1S,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-1-[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]triazole-4-carboxamide (PubChem CID 167924410) has the molecular formula C24H24N6O4 and a molecular weight of 460.49 g/mol. Its IUPAC name is N-[[(1S,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-1-[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]triazole-4-carboxamide.
| Compound Name | N-[[(1S,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-1-[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 167924410 |
| Molecular Formula | C24H24N6O4 |
| Molecular Weight | 460.49 g/mol |
| Exact Mass | 460.19 |
| IUPAC Name | N-[[(1S,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-1-[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]triazole-4-carboxamide |
| SMILES | O=C1CCC(N2Cc3ccc(-n4cc(C(=O)NC[C@@H]5C[C@H]6C=C[C@@H]5C6)nn4)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C24H24N6O4/c31-21-6-5-20(23(33)26-21)29-11-15-3-4-17(9-18(15)24(29)34)30-12-19(27-28-30)22(32)25-10-16-8-13-1-2-14(16)7-13/h1-4,9,12-14,16,20H,5-8,10-11H2,(H,25,32)(H,26,31,33)/t13-,14+,16-,20?/m0/s1 |
| InChIKey | OMAODWBFZNAAPA-RIGINYJASA-N |
| XLogP | 0.97 |
| TPSA | 126.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.49 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|