C26H24N6O4 — CID 167819524
3-[5-[4-(2-benzylazetidine-1-carbonyl)triazol-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 167819524) has the molecular formula C26H24N6O4 and a molecular weight of 484.52 g/mol. Its IUPAC name is 3-[5-[4-(2-benzylazetidine-1-carbonyl)triazol-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[5-[4-(2-benzylazetidine-1-carbonyl)triazol-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 167819524 |
| Molecular Formula | C26H24N6O4 |
| Molecular Weight | 484.52 g/mol |
| Exact Mass | 484.19 |
| IUPAC Name | 3-[5-[4-(2-benzylazetidine-1-carbonyl)triazol-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3ccc(-n4cc(C(=O)N5CCC5Cc5ccccc5)nn4)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C26H24N6O4/c33-23-9-8-22(24(34)27-23)31-14-17-6-7-19(13-20(17)25(31)35)32-15-21(28-29-32)26(36)30-11-10-18(30)12-16-4-2-1-3-5-16/h1-7,13,15,18,22H,8-12,14H2,(H,27,33,34) |
| InChIKey | WPHFIHMOHQVPRP-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 117.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.52 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|