C23H19N7O3 — CID 167754871
3-[6-[4-(benzimidazol-1-ylmethyl)triazol-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 167754871) has the molecular formula C23H19N7O3 and a molecular weight of 441.45 g/mol. Its IUPAC name is 3-[6-[4-(benzimidazol-1-ylmethyl)triazol-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[4-(benzimidazol-1-ylmethyl)triazol-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 167754871 |
| Molecular Formula | C23H19N7O3 |
| Molecular Weight | 441.45 g/mol |
| Exact Mass | 441.15 |
| IUPAC Name | 3-[6-[4-(benzimidazol-1-ylmethyl)triazol-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(-n4cc(Cn5cnc6ccccc65)nn4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C23H19N7O3/c31-21-8-7-20(22(32)25-21)29-10-14-9-16(5-6-17(14)23(29)33)30-12-15(26-27-30)11-28-13-24-18-3-1-2-4-19(18)28/h1-6,9,12-13,20H,7-8,10-11H2,(H,25,31,32) |
| InChIKey | RQBIEERHASRHAV-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 115.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.45 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|