C25H21N7O3 — CID 167780794
3-[3-oxo-5-[4-[(4-phenylimidazol-1-yl)methyl]triazol-1-yl]-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 167780794) has the molecular formula C25H21N7O3 and a molecular weight of 467.49 g/mol. Its IUPAC name is 3-[3-oxo-5-[4-[(4-phenylimidazol-1-yl)methyl]triazol-1-yl]-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[3-oxo-5-[4-[(4-phenylimidazol-1-yl)methyl]triazol-1-yl]-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 167780794 |
| Molecular Formula | C25H21N7O3 |
| Molecular Weight | 467.49 g/mol |
| Exact Mass | 467.17 |
| IUPAC Name | 3-[3-oxo-5-[4-[(4-phenylimidazol-1-yl)methyl]triazol-1-yl]-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3ccc(-n4cc(Cn5cnc(-c6ccccc6)c5)nn4)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C25H21N7O3/c33-23-9-8-22(24(34)27-23)31-11-17-6-7-19(10-20(17)25(31)35)32-13-18(28-29-32)12-30-14-21(26-15-30)16-4-2-1-3-5-16/h1-7,10,13-15,22H,8-9,11-12H2,(H,27,33,34) |
| InChIKey | GQKVLADUMATZSE-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 115.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.49 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|