C20H19N7O4 — CID 167828580
3-[6-[4-[(1-methylpyrazol-4-yl)oxymethyl]triazol-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 167828580) has the molecular formula C20H19N7O4 and a molecular weight of 421.42 g/mol. Its IUPAC name is 3-[6-[4-[(1-methylpyrazol-4-yl)oxymethyl]triazol-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[4-[(1-methylpyrazol-4-yl)oxymethyl]triazol-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 167828580 |
| Molecular Formula | C20H19N7O4 |
| Molecular Weight | 421.42 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | 3-[6-[4-[(1-methylpyrazol-4-yl)oxymethyl]triazol-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | Cn1cc(OCc2cn(-c3ccc4c(c3)CN(C3CCC(=O)NC3=O)C4=O)nn2)cn1 |
| InChI | InChI=1S/C20H19N7O4/c1-25-10-15(7-21-25)31-11-13-9-27(24-23-13)14-2-3-16-12(6-14)8-26(20(16)30)17-4-5-18(28)22-19(17)29/h2-3,6-7,9-10,17H,4-5,8,11H2,1H3,(H,22,28,29) |
| InChIKey | LWOPBUPQFXLBSA-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 124.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.42 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|