C21H19N7O5 — CID 176972047
methyl 2-[4-[1-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]triazol-4-yl]pyrazol-1-yl]acetate (PubChem CID 176972047) has the molecular formula C21H19N7O5 and a molecular weight of 449.43 g/mol. Its IUPAC name is methyl 2-[4-[1-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]triazol-4-yl]pyrazol-1-yl]acetate.
| Compound Name | methyl 2-[4-[1-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]triazol-4-yl]pyrazol-1-yl]acetate |
|---|---|
| PubChem CID | 176972047 |
| Molecular Formula | C21H19N7O5 |
| Molecular Weight | 449.43 g/mol |
| Exact Mass | 449.14 |
| IUPAC Name | methyl 2-[4-[1-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]triazol-4-yl]pyrazol-1-yl]acetate |
| SMILES | COC(=O)Cn1cc(-c2cn(-c3ccc4c(c3)CN(C3CCC(=O)NC3=O)C4=O)nn2)cn1 |
| InChI | InChI=1S/C21H19N7O5/c1-33-19(30)11-26-8-13(7-22-26)16-10-28(25-24-16)14-2-3-15-12(6-14)9-27(21(15)32)17-4-5-18(29)23-20(17)31/h2-3,6-8,10,17H,4-5,9,11H2,1H3,(H,23,29,31) |
| InChIKey | RPVKPUSRXNPHMR-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 141.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.43 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|