C22H18ClN5O3 — CID 167948377
3-[6-[4-(3-chloro-4-methylphenyl)triazol-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 167948377) has the molecular formula C22H18ClN5O3 and a molecular weight of 435.87 g/mol. Its IUPAC name is 3-[6-[4-(3-chloro-4-methylphenyl)triazol-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[4-(3-chloro-4-methylphenyl)triazol-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 167948377 |
| Molecular Formula | C22H18ClN5O3 |
| Molecular Weight | 435.87 g/mol |
| Exact Mass | 435.11 |
| IUPAC Name | 3-[6-[4-(3-chloro-4-methylphenyl)triazol-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | Cc1ccc(-c2cn(-c3ccc4c(c3)CN(C3CCC(=O)NC3=O)C4=O)nn2)cc1Cl |
| InChI | InChI=1S/C22H18ClN5O3/c1-12-2-3-13(9-17(12)23)18-11-28(26-25-18)15-4-5-16-14(8-15)10-27(22(16)31)19-6-7-20(29)24-21(19)30/h2-5,8-9,11,19H,6-7,10H2,1H3,(H,24,29,30) |
| InChIKey | XVTMKAJVCGYCLW-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.87 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|