C21H24N6O3 — CID 167947567
3-[6-[4-(1-methylpiperidin-3-yl)triazol-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 167947567) has the molecular formula C21H24N6O3 and a molecular weight of 408.46 g/mol. Its IUPAC name is 3-[6-[4-(1-methylpiperidin-3-yl)triazol-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[4-(1-methylpiperidin-3-yl)triazol-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 167947567 |
| Molecular Formula | C21H24N6O3 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | 3-[6-[4-(1-methylpiperidin-3-yl)triazol-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | CN1CCCC(c2cn(-c3ccc4c(c3)CN(C3CCC(=O)NC3=O)C4=O)nn2)C1 |
| InChI | InChI=1S/C21H24N6O3/c1-25-8-2-3-13(10-25)17-12-27(24-23-17)15-4-5-16-14(9-15)11-26(21(16)30)18-6-7-19(28)22-20(18)29/h4-5,9,12-13,18H,2-3,6-8,10-11H2,1H3,(H,22,28,29) |
| InChIKey | DQNDBLFPSCNLQS-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 100.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|