C25H23N5O5 — CID 176972096
3-[6-[4-(8-methoxy-4a,8a-dihydro-2H-chromen-3-yl)triazol-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 176972096) has the molecular formula C25H23N5O5 and a molecular weight of 473.49 g/mol. Its IUPAC name is 3-[6-[4-(8-methoxy-4a,8a-dihydro-2H-chromen-3-yl)triazol-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[4-(8-methoxy-4a,8a-dihydro-2H-chromen-3-yl)triazol-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 176972096 |
| Molecular Formula | C25H23N5O5 |
| Molecular Weight | 473.49 g/mol |
| Exact Mass | 473.17 |
| IUPAC Name | 3-[6-[4-(8-methoxy-4a,8a-dihydro-2H-chromen-3-yl)triazol-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | COC1=CC=CC2C=C(c3cn(-c4ccc5c(c4)CN(C4CCC(=O)NC4=O)C5=O)nn3)COC12 |
| InChI | InChI=1S/C25H23N5O5/c1-34-21-4-2-3-14-9-16(13-35-23(14)21)19-12-30(28-27-19)17-5-6-18-15(10-17)11-29(25(18)33)20-7-8-22(31)26-24(20)32/h2-6,9-10,12,14,20,23H,7-8,11,13H2,1H3,(H,26,31,32) |
| InChIKey | PASCONTZVRLUQA-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 115.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.49 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|