C22H20N6O4 — CID 176972204
3-[6-[1-[6-(methoxymethyl)-2-pyridinyl]triazol-4-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 176972204) has the molecular formula C22H20N6O4 and a molecular weight of 432.44 g/mol. Its IUPAC name is 3-[6-[1-[6-(methoxymethyl)-2-pyridinyl]triazol-4-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[1-[6-(methoxymethyl)-2-pyridinyl]triazol-4-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 176972204 |
| Molecular Formula | C22H20N6O4 |
| Molecular Weight | 432.44 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | 3-[6-[1-[6-(methoxymethyl)-2-pyridinyl]triazol-4-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | COCc1cccc(-n2cc(-c3ccc4c(c3)CN(C3CCC(=O)NC3=O)C4=O)nn2)n1 |
| InChI | InChI=1S/C22H20N6O4/c1-32-12-15-3-2-4-19(23-15)28-11-17(25-26-28)13-5-6-16-14(9-13)10-27(22(16)31)18-7-8-20(29)24-21(18)30/h2-6,9,11,18H,7-8,10,12H2,1H3,(H,24,29,30) |
| InChIKey | ZXUVATPUTPGYGP-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 119.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.44 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|