C24H24N6O5 — CID 176972115
3-[6-[1-[6-(2-methoxyethoxymethyl)-2-pyridinyl]triazol-4-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 176972115) has the molecular formula C24H24N6O5 and a molecular weight of 476.49 g/mol. Its IUPAC name is 3-[6-[1-[6-(2-methoxyethoxymethyl)-2-pyridinyl]triazol-4-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[1-[6-(2-methoxyethoxymethyl)-2-pyridinyl]triazol-4-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 176972115 |
| Molecular Formula | C24H24N6O5 |
| Molecular Weight | 476.49 g/mol |
| Exact Mass | 476.18 |
| IUPAC Name | 3-[6-[1-[6-(2-methoxyethoxymethyl)-2-pyridinyl]triazol-4-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | COCCOCc1cccc(-n2cc(-c3ccc4c(c3)CN(C3CCC(=O)NC3=O)C4=O)nn2)n1 |
| InChI | InChI=1S/C24H24N6O5/c1-34-9-10-35-14-17-3-2-4-21(25-17)30-13-19(27-28-30)15-5-6-18-16(11-15)12-29(24(18)33)20-7-8-22(31)26-23(20)32/h2-6,11,13,20H,7-10,12,14H2,1H3,(H,26,31,32) |
| InChIKey | ZNYNWMAGAYJOFX-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 128.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.49 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|