C16H16N2O6 — CID 171588190
methyl 2-(2,6-dioxopiperidin-3-yl)-6-(hydroxymethyl)-1-oxo-3H-isoindole-5-carboxylate (PubChem CID 171588190) has the molecular formula C16H16N2O6 and a molecular weight of 332.31 g/mol. Its IUPAC name is methyl 2-(2,6-dioxopiperidin-3-yl)-6-(hydroxymethyl)-1-oxo-3H-isoindole-5-carboxylate.
| Compound Name | methyl 2-(2,6-dioxopiperidin-3-yl)-6-(hydroxymethyl)-1-oxo-3H-isoindole-5-carboxylate |
|---|---|
| PubChem CID | 171588190 |
| Molecular Formula | C16H16N2O6 |
| Molecular Weight | 332.31 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | methyl 2-(2,6-dioxopiperidin-3-yl)-6-(hydroxymethyl)-1-oxo-3H-isoindole-5-carboxylate |
| SMILES | COC(=O)c1cc2c(cc1CO)C(=O)N(C1CCC(=O)NC1=O)C2 |
| InChI | InChI=1S/C16H16N2O6/c1-24-16(23)11-4-8-6-18(12-2-3-13(20)17-14(12)21)15(22)10(8)5-9(11)7-19/h4-5,12,19H,2-3,6-7H2,1H3,(H,17,20,21) |
| InChIKey | VNDRHLRUNLWEDE-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.31 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|