C19H17N3O6 — CID 177241489
methyl 2-[3-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-1,2-oxazol-5-yl]acetate (PubChem CID 177241489) has the molecular formula C19H17N3O6 and a molecular weight of 383.36 g/mol. Its IUPAC name is methyl 2-[3-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-1,2-oxazol-5-yl]acetate.
| Compound Name | methyl 2-[3-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-1,2-oxazol-5-yl]acetate |
|---|---|
| PubChem CID | 177241489 |
| Molecular Formula | C19H17N3O6 |
| Molecular Weight | 383.36 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | methyl 2-[3-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-1,2-oxazol-5-yl]acetate |
| SMILES | COC(=O)Cc1cc(-c2ccc3c(c2)CN(C2CCC(=O)NC2=O)C3=O)no1 |
| InChI | InChI=1S/C19H17N3O6/c1-27-17(24)8-12-7-14(21-28-12)10-2-3-13-11(6-10)9-22(19(13)26)15-4-5-16(23)20-18(15)25/h2-3,6-7,15H,4-5,8-9H2,1H3,(H,20,23,25) |
| InChIKey | HIWJXGCWEFNPIM-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 118.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.36 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|