C22H16F2N4O4 — CID 177241369
3-[6-[3-[5-(difluoromethyl)-2-pyridinyl]-1,2-oxazol-5-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 177241369) has the molecular formula C22H16F2N4O4 and a molecular weight of 438.39 g/mol. Its IUPAC name is 3-[6-[3-[5-(difluoromethyl)-2-pyridinyl]-1,2-oxazol-5-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[3-[5-(difluoromethyl)-2-pyridinyl]-1,2-oxazol-5-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 177241369 |
| Molecular Formula | C22H16F2N4O4 |
| Molecular Weight | 438.39 g/mol |
| Exact Mass | 438.11 |
| IUPAC Name | 3-[6-[3-[5-(difluoromethyl)-2-pyridinyl]-1,2-oxazol-5-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(-c4cc(-c5ccc(C(F)F)cn5)no4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C22H16F2N4O4/c23-20(24)12-2-4-15(25-9-12)16-8-18(32-27-16)11-1-3-14-13(7-11)10-28(22(14)31)17-5-6-19(29)26-21(17)30/h1-4,7-9,17,20H,5-6,10H2,(H,26,29,30) |
| InChIKey | LSPYQQUSIOWKIK-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 105.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.39 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|