C19H15N5O3 — CID 177241125
3-(6-imidazo[1,2-a]pyrazin-6-yl-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione (PubChem CID 177241125) has the molecular formula C19H15N5O3 and a molecular weight of 361.36 g/mol. Its IUPAC name is 3-(6-imidazo[1,2-a]pyrazin-6-yl-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione.
| Compound Name | 3-(6-imidazo[1,2-a]pyrazin-6-yl-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 177241125 |
| Molecular Formula | C19H15N5O3 |
| Molecular Weight | 361.36 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | 3-(6-imidazo[1,2-a]pyrazin-6-yl-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(-c4cn5ccnc5cn4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C19H15N5O3/c25-17-4-3-15(18(26)22-17)24-9-12-7-11(1-2-13(12)19(24)27)14-10-23-6-5-20-16(23)8-21-14/h1-2,5-8,10,15H,3-4,9H2,(H,22,25,26) |
| InChIKey | IWGLBMJDXTUANT-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 96.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.36 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|