C21H20N6O3 — CID 166174017
3-[6-[1-methyl-4-(methylamino)imidazo[4,5-c]pyridin-6-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 166174017) has the molecular formula C21H20N6O3 and a molecular weight of 404.43 g/mol. Its IUPAC name is 3-[6-[1-methyl-4-(methylamino)imidazo[4,5-c]pyridin-6-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[1-methyl-4-(methylamino)imidazo[4,5-c]pyridin-6-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 166174017 |
| Molecular Formula | C21H20N6O3 |
| Molecular Weight | 404.43 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | 3-[6-[1-methyl-4-(methylamino)imidazo[4,5-c]pyridin-6-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | CNc1nc(-c2ccc3c(c2)CN(C2CCC(=O)NC2=O)C3=O)cc2c1ncn2C |
| InChI | InChI=1S/C21H20N6O3/c1-22-19-18-16(26(2)10-23-18)8-14(24-19)11-3-4-13-12(7-11)9-27(21(13)30)15-5-6-17(28)25-20(15)29/h3-4,7-8,10,15H,5-6,9H2,1-2H3,(H,22,24)(H,25,28,29) |
| InChIKey | KPAHKZXKSXJDNA-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 109.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.43 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|