C29H27N5O3 — CID 171577605
3-[6-[2-[4-(2,5-dimethylpyrrol-1-yl)phenyl]-1-methylimidazol-4-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 171577605) has the molecular formula C29H27N5O3 and a molecular weight of 493.57 g/mol. Its IUPAC name is 3-[6-[2-[4-(2,5-dimethylpyrrol-1-yl)phenyl]-1-methylimidazol-4-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[2-[4-(2,5-dimethylpyrrol-1-yl)phenyl]-1-methylimidazol-4-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 171577605 |
| Molecular Formula | C29H27N5O3 |
| Molecular Weight | 493.57 g/mol |
| Exact Mass | 493.21 |
| IUPAC Name | 3-[6-[2-[4-(2,5-dimethylpyrrol-1-yl)phenyl]-1-methylimidazol-4-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | Cc1ccc(C)n1-c1ccc(-c2nc(-c3ccc4c(c3)CN(C3CCC(=O)NC3=O)C4=O)cn2C)cc1 |
| InChI | InChI=1S/C29H27N5O3/c1-17-4-5-18(2)34(17)22-9-6-19(7-10-22)27-30-24(16-32(27)3)20-8-11-23-21(14-20)15-33(29(23)37)25-12-13-26(35)31-28(25)36/h4-11,14,16,25H,12-13,15H2,1-3H3,(H,31,35,36) |
| InChIKey | KPIYCJCZROXVQO-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 89.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.57 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|