C26H21N5O3 — CID 177241194
3-[6-[1-(4-aminophenyl)benzimidazol-2-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 177241194) has the molecular formula C26H21N5O3 and a molecular weight of 451.49 g/mol. Its IUPAC name is 3-[6-[1-(4-aminophenyl)benzimidazol-2-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[1-(4-aminophenyl)benzimidazol-2-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 177241194 |
| Molecular Formula | C26H21N5O3 |
| Molecular Weight | 451.49 g/mol |
| Exact Mass | 451.16 |
| IUPAC Name | 3-[6-[1-(4-aminophenyl)benzimidazol-2-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | Nc1ccc(-n2c(-c3ccc4c(c3)CN(C3CCC(=O)NC3=O)C4=O)nc3ccccc32)cc1 |
| InChI | InChI=1S/C26H21N5O3/c27-17-6-8-18(9-7-17)31-21-4-2-1-3-20(21)28-24(31)15-5-10-19-16(13-15)14-30(26(19)34)22-11-12-23(32)29-25(22)33/h1-10,13,22H,11-12,14,27H2,(H,29,32,33) |
| InChIKey | SQEHPPSPQUREMX-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 110.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.49 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|