C29H21F3N4O3 — CID 177241101
3-[6-[4,5-diphenyl-1-(trifluoromethyl)imidazol-2-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 177241101) has the molecular formula C29H21F3N4O3 and a molecular weight of 530.51 g/mol. Its IUPAC name is 3-[6-[4,5-diphenyl-1-(trifluoromethyl)imidazol-2-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[4,5-diphenyl-1-(trifluoromethyl)imidazol-2-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 177241101 |
| Molecular Formula | C29H21F3N4O3 |
| Molecular Weight | 530.51 g/mol |
| Exact Mass | 530.16 |
| IUPAC Name | 3-[6-[4,5-diphenyl-1-(trifluoromethyl)imidazol-2-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(-c4nc(-c5ccccc5)c(-c5ccccc5)n4C(F)(F)F)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C29H21F3N4O3/c30-29(31,32)36-25(18-9-5-2-6-10-18)24(17-7-3-1-4-8-17)34-26(36)19-11-12-21-20(15-19)16-35(28(21)39)22-13-14-23(37)33-27(22)38/h1-12,15,22H,13-14,16H2,(H,33,37,38) |
| InChIKey | XTXRRCSYOGCQGJ-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.51 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|