C24H20F3N5O3 — CID 177241306
3-[6-[5-(3-aminophenyl)-1-methyl-2-(trifluoromethyl)imidazol-4-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 177241306) has the molecular formula C24H20F3N5O3 and a molecular weight of 483.45 g/mol. Its IUPAC name is 3-[6-[5-(3-aminophenyl)-1-methyl-2-(trifluoromethyl)imidazol-4-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[5-(3-aminophenyl)-1-methyl-2-(trifluoromethyl)imidazol-4-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 177241306 |
| Molecular Formula | C24H20F3N5O3 |
| Molecular Weight | 483.45 g/mol |
| Exact Mass | 483.15 |
| IUPAC Name | 3-[6-[5-(3-aminophenyl)-1-methyl-2-(trifluoromethyl)imidazol-4-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | Cn1c(C(F)(F)F)nc(-c2ccc3c(c2)CN(C2CCC(=O)NC2=O)C3=O)c1-c1cccc(N)c1 |
| InChI | InChI=1S/C24H20F3N5O3/c1-31-20(13-3-2-4-15(28)10-13)19(30-23(31)24(25,26)27)12-5-6-16-14(9-12)11-32(22(16)35)17-7-8-18(33)29-21(17)34/h2-6,9-10,17H,7-8,11,28H2,1H3,(H,29,33,34) |
| InChIKey | HJUXNPJNGJIXHY-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 110.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.45 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|