C23H18F3N5O4 — CID 177241040
3-[6-[5-(3-methoxyphenyl)-1-(trifluoromethyl)triazol-4-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 177241040) has the molecular formula C23H18F3N5O4 and a molecular weight of 485.42 g/mol. Its IUPAC name is 3-[6-[5-(3-methoxyphenyl)-1-(trifluoromethyl)triazol-4-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[5-(3-methoxyphenyl)-1-(trifluoromethyl)triazol-4-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 177241040 |
| Molecular Formula | C23H18F3N5O4 |
| Molecular Weight | 485.42 g/mol |
| Exact Mass | 485.13 |
| IUPAC Name | 3-[6-[5-(3-methoxyphenyl)-1-(trifluoromethyl)triazol-4-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | COc1cccc(-c2c(-c3ccc4c(c3)CN(C3CCC(=O)NC3=O)C4=O)nnn2C(F)(F)F)c1 |
| InChI | InChI=1S/C23H18F3N5O4/c1-35-15-4-2-3-13(10-15)20-19(28-29-31(20)23(24,25)26)12-5-6-16-14(9-12)11-30(22(16)34)17-7-8-18(32)27-21(17)33/h2-6,9-10,17H,7-8,11H2,1H3,(H,27,32,33) |
| InChIKey | QOLFVWZVUJNYAF-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 106.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.42 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|