C22H18N6O5 — CID 177240950
3-[6-[5-methyl-1-(3-nitrophenyl)triazol-4-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 177240950) has the molecular formula C22H18N6O5 and a molecular weight of 446.42 g/mol. Its IUPAC name is 3-[6-[5-methyl-1-(3-nitrophenyl)triazol-4-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[5-methyl-1-(3-nitrophenyl)triazol-4-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 177240950 |
| Molecular Formula | C22H18N6O5 |
| Molecular Weight | 446.42 g/mol |
| Exact Mass | 446.13 |
| IUPAC Name | 3-[6-[5-methyl-1-(3-nitrophenyl)triazol-4-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | Cc1c(-c2ccc3c(c2)CN(C2CCC(=O)NC2=O)C3=O)nnn1-c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H18N6O5/c1-12-20(24-25-27(12)15-3-2-4-16(10-15)28(32)33)13-5-6-17-14(9-13)11-26(22(17)31)18-7-8-19(29)23-21(18)30/h2-6,9-10,18H,7-8,11H2,1H3,(H,23,29,30) |
| InChIKey | XJBYZAZKVXHYTL-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 140.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.42 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|