C23H19F2N5O3 — CID 177241479
3-[6-[5-(1,1-difluoroethyl)-1-phenyltriazol-4-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 177241479) has the molecular formula C23H19F2N5O3 and a molecular weight of 451.43 g/mol. Its IUPAC name is 3-[6-[5-(1,1-difluoroethyl)-1-phenyltriazol-4-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[5-(1,1-difluoroethyl)-1-phenyltriazol-4-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 177241479 |
| Molecular Formula | C23H19F2N5O3 |
| Molecular Weight | 451.43 g/mol |
| Exact Mass | 451.15 |
| IUPAC Name | 3-[6-[5-(1,1-difluoroethyl)-1-phenyltriazol-4-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | CC(F)(F)c1c(-c2ccc3c(c2)CN(C2CCC(=O)NC2=O)C3=O)nnn1-c1ccccc1 |
| InChI | InChI=1S/C23H19F2N5O3/c1-23(24,25)20-19(27-28-30(20)15-5-3-2-4-6-15)13-7-8-16-14(11-13)12-29(22(16)33)17-9-10-18(31)26-21(17)32/h2-8,11,17H,9-10,12H2,1H3,(H,26,31,32) |
| InChIKey | SAAQVXXGNVNZCA-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.43 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|