C23H21N5O3 — CID 166174002
3-[6-[3-(ethylamino)quinoxalin-2-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 166174002) has the molecular formula C23H21N5O3 and a molecular weight of 415.45 g/mol. Its IUPAC name is 3-[6-[3-(ethylamino)quinoxalin-2-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[3-(ethylamino)quinoxalin-2-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 166174002 |
| Molecular Formula | C23H21N5O3 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | 3-[6-[3-(ethylamino)quinoxalin-2-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | CCNc1nc2ccccc2nc1-c1ccc2c(c1)CN(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C23H21N5O3/c1-2-24-21-20(25-16-5-3-4-6-17(16)26-21)13-7-8-15-14(11-13)12-28(23(15)31)18-9-10-19(29)27-22(18)30/h3-8,11,18H,2,9-10,12H2,1H3,(H,24,26)(H,27,29,30) |
| InChIKey | MRRVJPULAAUWFR-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|