C24H25N5O3 — CID 177144092
3-[6-[3-(tert-butylamino)imidazo[1,2-a]pyridin-2-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 177144092) has the molecular formula C24H25N5O3 and a molecular weight of 431.50 g/mol. Its IUPAC name is 3-[6-[3-(tert-butylamino)imidazo[1,2-a]pyridin-2-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[3-(tert-butylamino)imidazo[1,2-a]pyridin-2-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 177144092 |
| Molecular Formula | C24H25N5O3 |
| Molecular Weight | 431.50 g/mol |
| Exact Mass | 431.20 |
| IUPAC Name | 3-[6-[3-(tert-butylamino)imidazo[1,2-a]pyridin-2-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | CC(C)(C)Nc1c(-c2ccc3c(c2)CN(C2CCC(=O)NC2=O)C3=O)nc2ccccn12 |
| InChI | InChI=1S/C24H25N5O3/c1-24(2,3)27-21-20(25-18-6-4-5-11-28(18)21)14-7-8-16-15(12-14)13-29(23(16)32)17-9-10-19(30)26-22(17)31/h4-8,11-12,17,27H,9-10,13H2,1-3H3,(H,26,30,31) |
| InChIKey | IFLAYQIAAFCPNM-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 95.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.50 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|