C22H17N3O4 — CID 171075864
3-[3-oxo-6-(5-phenyl-1,2-oxazol-4-yl)-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 171075864) has the molecular formula C22H17N3O4 and a molecular weight of 387.40 g/mol. Its IUPAC name is 3-[3-oxo-6-(5-phenyl-1,2-oxazol-4-yl)-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[3-oxo-6-(5-phenyl-1,2-oxazol-4-yl)-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 171075864 |
| Molecular Formula | C22H17N3O4 |
| Molecular Weight | 387.40 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | 3-[3-oxo-6-(5-phenyl-1,2-oxazol-4-yl)-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(-c4cnoc4-c4ccccc4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C22H17N3O4/c26-19-9-8-18(21(27)24-19)25-12-15-10-14(6-7-16(15)22(25)28)17-11-23-29-20(17)13-4-2-1-3-5-13/h1-7,10-11,18H,8-9,12H2,(H,24,26,27) |
| InChIKey | VKVQNVFNGLJZGN-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.40 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|