C27H23F2N3O4 — CID 177241097
3-[6-[2-[(3,3-difluorocyclobutyl)methyl]-5-phenyl-1,3-oxazol-4-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 177241097) has the molecular formula C27H23F2N3O4 and a molecular weight of 491.49 g/mol. Its IUPAC name is 3-[6-[2-[(3,3-difluorocyclobutyl)methyl]-5-phenyl-1,3-oxazol-4-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[2-[(3,3-difluorocyclobutyl)methyl]-5-phenyl-1,3-oxazol-4-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 177241097 |
| Molecular Formula | C27H23F2N3O4 |
| Molecular Weight | 491.49 g/mol |
| Exact Mass | 491.17 |
| IUPAC Name | 3-[6-[2-[(3,3-difluorocyclobutyl)methyl]-5-phenyl-1,3-oxazol-4-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(-c4nc(CC5CC(F)(F)C5)oc4-c4ccccc4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C27H23F2N3O4/c28-27(29)12-15(13-27)10-22-31-23(24(36-22)16-4-2-1-3-5-16)17-6-7-19-18(11-17)14-32(26(19)35)20-8-9-21(33)30-25(20)34/h1-7,11,15,20H,8-10,12-14H2,(H,30,33,34) |
| InChIKey | GSPHGDMIKISUOF-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.49 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|