C24H19N5O4 — CID 177241109
3-[6-[5-(1-benzofuran-5-yl)-1-methyltriazol-4-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 177241109) has the molecular formula C24H19N5O4 and a molecular weight of 441.45 g/mol. Its IUPAC name is 3-[6-[5-(1-benzofuran-5-yl)-1-methyltriazol-4-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[5-(1-benzofuran-5-yl)-1-methyltriazol-4-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 177241109 |
| Molecular Formula | C24H19N5O4 |
| Molecular Weight | 441.45 g/mol |
| Exact Mass | 441.14 |
| IUPAC Name | 3-[6-[5-(1-benzofuran-5-yl)-1-methyltriazol-4-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | Cn1nnc(-c2ccc3c(c2)CN(C2CCC(=O)NC2=O)C3=O)c1-c1ccc2occc2c1 |
| InChI | InChI=1S/C24H19N5O4/c1-28-22(15-3-6-19-13(10-15)8-9-33-19)21(26-27-28)14-2-4-17-16(11-14)12-29(24(17)32)18-5-7-20(30)25-23(18)31/h2-4,6,8-11,18H,5,7,12H2,1H3,(H,25,30,31) |
| InChIKey | PVZXSKDXKUVDTA-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 110.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.45 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|