C23H16F4N4O3 — CID 177241247
3-[5-fluoro-3-oxo-6-[5-phenyl-1-(trifluoromethyl)imidazol-4-yl]-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 177241247) has the molecular formula C23H16F4N4O3 and a molecular weight of 472.40 g/mol. Its IUPAC name is 3-[5-fluoro-3-oxo-6-[5-phenyl-1-(trifluoromethyl)imidazol-4-yl]-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[5-fluoro-3-oxo-6-[5-phenyl-1-(trifluoromethyl)imidazol-4-yl]-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 177241247 |
| Molecular Formula | C23H16F4N4O3 |
| Molecular Weight | 472.40 g/mol |
| Exact Mass | 472.12 |
| IUPAC Name | 3-[5-fluoro-3-oxo-6-[5-phenyl-1-(trifluoromethyl)imidazol-4-yl]-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(-c4ncn(C(F)(F)F)c4-c4ccccc4)c(F)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C23H16F4N4O3/c24-16-9-14-13(10-30(22(14)34)17-6-7-18(32)29-21(17)33)8-15(16)19-20(12-4-2-1-3-5-12)31(11-28-19)23(25,26)27/h1-5,8-9,11,17H,6-7,10H2,(H,29,32,33) |
| InChIKey | BSWLWEMOQCWECL-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.40 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|