C24H21FN4O3 — CID 177241215
3-[6-(1,4-dimethyl-5-phenylpyrazol-3-yl)-5-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 177241215) has the molecular formula C24H21FN4O3 and a molecular weight of 432.46 g/mol. Its IUPAC name is 3-[6-(1,4-dimethyl-5-phenylpyrazol-3-yl)-5-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-(1,4-dimethyl-5-phenylpyrazol-3-yl)-5-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 177241215 |
| Molecular Formula | C24H21FN4O3 |
| Molecular Weight | 432.46 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | 3-[6-(1,4-dimethyl-5-phenylpyrazol-3-yl)-5-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | Cc1c(-c2cc3c(cc2F)C(=O)N(C2CCC(=O)NC2=O)C3)nn(C)c1-c1ccccc1 |
| InChI | InChI=1S/C24H21FN4O3/c1-13-21(27-28(2)22(13)14-6-4-3-5-7-14)17-10-15-12-29(24(32)16(15)11-18(17)25)19-8-9-20(30)26-23(19)31/h3-7,10-11,19H,8-9,12H2,1-2H3,(H,26,30,31) |
| InChIKey | DQXGBWGDXHRCOY-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.46 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|