C18H20F2N4O4 — CID 134580025
3-[4-(difluoromethoxy)-3-oxo-6-piperazin-1-yl-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 134580025) has the molecular formula C18H20F2N4O4 and a molecular weight of 394.38 g/mol. Its IUPAC name is 3-[4-(difluoromethoxy)-3-oxo-6-piperazin-1-yl-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[4-(difluoromethoxy)-3-oxo-6-piperazin-1-yl-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 134580025 |
| Molecular Formula | C18H20F2N4O4 |
| Molecular Weight | 394.38 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | 3-[4-(difluoromethoxy)-3-oxo-6-piperazin-1-yl-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(N4CCNCC4)cc(OC(F)F)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C18H20F2N4O4/c19-18(20)28-13-8-11(23-5-3-21-4-6-23)7-10-9-24(17(27)15(10)13)12-1-2-14(25)22-16(12)26/h7-8,12,18,21H,1-6,9H2,(H,22,25,26) |
| InChIKey | WVBTUHKMHOXQQA-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.38 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|