C22H17F2N3O6 — CID 174550509
N-(3,4-difluoro-2-methoxybenzoyl)-2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindole-4-carboxamide (PubChem CID 174550509) has the molecular formula C22H17F2N3O6 and a molecular weight of 457.39 g/mol. Its IUPAC name is N-(3,4-difluoro-2-methoxybenzoyl)-2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindole-4-carboxamide.
| Compound Name | N-(3,4-difluoro-2-methoxybenzoyl)-2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindole-4-carboxamide |
|---|---|
| PubChem CID | 174550509 |
| Molecular Formula | C22H17F2N3O6 |
| Molecular Weight | 457.39 g/mol |
| Exact Mass | 457.11 |
| IUPAC Name | N-(3,4-difluoro-2-methoxybenzoyl)-2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindole-4-carboxamide |
| SMILES | COc1c(C(=O)NC(=O)c2cccc3c2C(=O)N(C2CCC(=O)NC2=O)C3)ccc(F)c1F |
| InChI | InChI=1S/C22H17F2N3O6/c1-33-18-12(5-6-13(23)17(18)24)20(30)26-19(29)11-4-2-3-10-9-27(22(32)16(10)11)14-7-8-15(28)25-21(14)31/h2-6,14H,7-9H2,1H3,(H,25,28,31)(H,26,29,30) |
| InChIKey | GMYFJVAMKVYYNQ-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.39 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|