C23H22FN3O4 — CID 178002255
2-(2,6-dioxopiperidin-3-yl)-N-[2-(4-fluorophenyl)propan-2-yl]-3-oxo-1H-isoindole-4-carboxamide (PubChem CID 178002255) has the molecular formula C23H22FN3O4 and a molecular weight of 423.44 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-N-[2-(4-fluorophenyl)propan-2-yl]-3-oxo-1H-isoindole-4-carboxamide.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-N-[2-(4-fluorophenyl)propan-2-yl]-3-oxo-1H-isoindole-4-carboxamide |
|---|---|
| PubChem CID | 178002255 |
| Molecular Formula | C23H22FN3O4 |
| Molecular Weight | 423.44 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-N-[2-(4-fluorophenyl)propan-2-yl]-3-oxo-1H-isoindole-4-carboxamide |
| SMILES | CC(C)(NC(=O)c1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2)c1ccc(F)cc1 |
| InChI | InChI=1S/C23H22FN3O4/c1-23(2,14-6-8-15(24)9-7-14)26-20(29)16-5-3-4-13-12-27(22(31)19(13)16)17-10-11-18(28)25-21(17)30/h3-9,17H,10-12H2,1-2H3,(H,26,29)(H,25,28,30) |
| InChIKey | QZPHCPKTRCJVIA-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.44 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|