C21H16Cl2N4O5 — CID 67230176
N-[(3,4-dichlorophenyl)carbamoyl]-2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindole-4-carboxamide (PubChem CID 67230176) has the molecular formula C21H16Cl2N4O5 and a molecular weight of 475.29 g/mol. Its IUPAC name is N-[(3,4-dichlorophenyl)carbamoyl]-2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindole-4-carboxamide.
| Compound Name | N-[(3,4-dichlorophenyl)carbamoyl]-2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindole-4-carboxamide |
|---|---|
| PubChem CID | 67230176 |
| Molecular Formula | C21H16Cl2N4O5 |
| Molecular Weight | 475.29 g/mol |
| Exact Mass | 474.05 |
| IUPAC Name | N-[(3,4-dichlorophenyl)carbamoyl]-2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindole-4-carboxamide |
| SMILES | O=C1CCC(N2Cc3cccc(C(=O)NC(=O)Nc4ccc(Cl)c(Cl)c4)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C21H16Cl2N4O5/c22-13-5-4-11(8-14(13)23)24-21(32)26-18(29)12-3-1-2-10-9-27(20(31)17(10)12)15-6-7-16(28)25-19(15)30/h1-5,8,15H,6-7,9H2,(H,25,28,30)(H2,24,26,29,32) |
| InChIKey | XHUPSDYGUFJVGR-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.29 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|