C21H20N4O4 — CID 67229967
2-(2,6-dioxopiperidin-3-yl)-N-(phenylcarbamoyl)-1,3-dihydroisoindole-4-carboxamide (PubChem CID 67229967) has the molecular formula C21H20N4O4 and a molecular weight of 392.42 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-N-(phenylcarbamoyl)-1,3-dihydroisoindole-4-carboxamide.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-N-(phenylcarbamoyl)-1,3-dihydroisoindole-4-carboxamide |
|---|---|
| PubChem CID | 67229967 |
| Molecular Formula | C21H20N4O4 |
| Molecular Weight | 392.42 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-N-(phenylcarbamoyl)-1,3-dihydroisoindole-4-carboxamide |
| SMILES | O=C1CCC(N2Cc3cccc(C(=O)NC(=O)Nc4ccccc4)c3C2)C(=O)N1 |
| InChI | InChI=1S/C21H20N4O4/c26-18-10-9-17(20(28)23-18)25-11-13-5-4-8-15(16(13)12-25)19(27)24-21(29)22-14-6-2-1-3-7-14/h1-8,17H,9-12H2,(H,23,26,28)(H2,22,24,27,29) |
| InChIKey | GTAWPKLACIYSSZ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.42 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|