C23H24N4O4 — CID 67023299
N-[(3,4-dimethylphenyl)carbamoyl]-2-(2,6-dioxopiperidin-3-yl)-1,3-dihydroisoindole-5-carboxamide (PubChem CID 67023299) has the molecular formula C23H24N4O4 and a molecular weight of 420.47 g/mol. Its IUPAC name is N-[(3,4-dimethylphenyl)carbamoyl]-2-(2,6-dioxopiperidin-3-yl)-1,3-dihydroisoindole-5-carboxamide.
| Compound Name | N-[(3,4-dimethylphenyl)carbamoyl]-2-(2,6-dioxopiperidin-3-yl)-1,3-dihydroisoindole-5-carboxamide |
|---|---|
| PubChem CID | 67023299 |
| Molecular Formula | C23H24N4O4 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | N-[(3,4-dimethylphenyl)carbamoyl]-2-(2,6-dioxopiperidin-3-yl)-1,3-dihydroisoindole-5-carboxamide |
| SMILES | Cc1ccc(NC(=O)NC(=O)c2ccc3c(c2)CN(C2CCC(=O)NC2=O)C3)cc1C |
| InChI | InChI=1S/C23H24N4O4/c1-13-3-6-18(9-14(13)2)24-23(31)26-21(29)15-4-5-16-11-27(12-17(16)10-15)19-7-8-20(28)25-22(19)30/h3-6,9-10,19H,7-8,11-12H2,1-2H3,(H,25,28,30)(H2,24,26,29,31) |
| InChIKey | MGQSCBQVRRYVFK-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|