C22H22N4O5 — CID 67023167
2-(2,6-dioxopiperidin-3-yl)-N-(6-ethoxypyridine-3-carbonyl)-1,3-dihydroisoindole-5-carboxamide (PubChem CID 67023167) has the molecular formula C22H22N4O5 and a molecular weight of 422.44 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-N-(6-ethoxypyridine-3-carbonyl)-1,3-dihydroisoindole-5-carboxamide.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-N-(6-ethoxypyridine-3-carbonyl)-1,3-dihydroisoindole-5-carboxamide |
|---|---|
| PubChem CID | 67023167 |
| Molecular Formula | C22H22N4O5 |
| Molecular Weight | 422.44 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-N-(6-ethoxypyridine-3-carbonyl)-1,3-dihydroisoindole-5-carboxamide |
| SMILES | CCOc1ccc(C(=O)NC(=O)c2ccc3c(c2)CN(C2CCC(=O)NC2=O)C3)cn1 |
| InChI | InChI=1S/C22H22N4O5/c1-2-31-19-8-5-14(10-23-19)21(29)25-20(28)13-3-4-15-11-26(12-16(15)9-13)17-6-7-18(27)24-22(17)30/h3-5,8-10,17H,2,6-7,11-12H2,1H3,(H,24,27,30)(H,25,28,29) |
| InChIKey | HINGPDLFADEGTC-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 117.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.44 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|